C13H13N3O2 — CID 121403174
(5R)-5-[(5-methyl-1H-indol-3-yl)methyl]imidazolidine-2,4-dione (PubChem CID 121403174) has the molecular formula C13H13N3O2 and a molecular weight of 243.27 g/mol. Its IUPAC name is (5R)-5-[(5-methyl-1H-indol-3-yl)methyl]imidazolidine-2,4-dione.
| Compound Name | (5R)-5-[(5-methyl-1H-indol-3-yl)methyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 121403174 |
| Molecular Formula | C13H13N3O2 |
| Molecular Weight | 243.27 g/mol |
| Exact Mass | 243.10 |
| IUPAC Name | (5R)-5-[(5-methyl-1H-indol-3-yl)methyl]imidazolidine-2,4-dione |
| SMILES | Cc1ccc2[nH]cc(C[C@H]3NC(=O)NC3=O)c2c1 |
| InChI | InChI=1S/C13H13N3O2/c1-7-2-3-10-9(4-7)8(6-14-10)5-11-12(17)16-13(18)15-11/h2-4,6,11,14H,5H2,1H3,(H2,15,16,17,18)/t11-/m1/s1 |
| InChIKey | IAKHTKVUVWMTHP-LLVKDONJSA-N |
| XLogP | 1.23 |
| TPSA | 73.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.27 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|