C12H9Cl2N3O2 — CID 121403172
(5R)-5-[(4,7-dichloro-1H-indol-3-yl)methyl]imidazolidine-2,4-dione (PubChem CID 121403172) has the molecular formula C12H9Cl2N3O2 and a molecular weight of 298.13 g/mol. Its IUPAC name is (5R)-5-[(4,7-dichloro-1H-indol-3-yl)methyl]imidazolidine-2,4-dione.
| Compound Name | (5R)-5-[(4,7-dichloro-1H-indol-3-yl)methyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 121403172 |
| Molecular Formula | C12H9Cl2N3O2 |
| Molecular Weight | 298.13 g/mol |
| Exact Mass | 297.01 |
| IUPAC Name | (5R)-5-[(4,7-dichloro-1H-indol-3-yl)methyl]imidazolidine-2,4-dione |
| SMILES | O=C1NC(=O)[C@@H](Cc2c[nH]c3c(Cl)ccc(Cl)c23)N1 |
| InChI | InChI=1S/C12H9Cl2N3O2/c13-6-1-2-7(14)10-9(6)5(4-15-10)3-8-11(18)17-12(19)16-8/h1-2,4,8,15H,3H2,(H2,16,17,18,19)/t8-/m1/s1 |
| InChIKey | BAPIVVRHZOUOIM-MRVPVSSYSA-N |
| XLogP | 2.23 |
| TPSA | 73.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.13 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|