C19H24ClN3O2S — CID 13286067
1-[3-(2-aminoethyl)-1H-indol-5-yl]-N-(2-phenylethyl)methanesulfonamide;hydrochloride (PubChem CID 13286067) has the molecular formula C19H24ClN3O2S and a molecular weight of 393.94 g/mol. Its IUPAC name is 1-[3-(2-aminoethyl)-1H-indol-5-yl]-N-(2-phenylethyl)methanesulfonamide;hydrochloride.
| Compound Name | 1-[3-(2-aminoethyl)-1H-indol-5-yl]-N-(2-phenylethyl)methanesulfonamide;hydrochloride |
|---|---|
| PubChem CID | 13286067 |
| Molecular Formula | C19H24ClN3O2S |
| Molecular Weight | 393.94 g/mol |
| Exact Mass | 393.13 |
| IUPAC Name | 1-[3-(2-aminoethyl)-1H-indol-5-yl]-N-(2-phenylethyl)methanesulfonamide;hydrochloride |
| SMILES | Cl.NCCc1c[nH]c2ccc(CS(=O)(=O)NCCc3ccccc3)cc12 |
| InChI | InChI=1S/C19H23N3O2S.ClH/c20-10-8-17-13-21-19-7-6-16(12-18(17)19)14-25(23,24)22-11-9-15-4-2-1-3-5-15;/h1-7,12-13,21-22H,8-11,14,20H2;1H |
| InChIKey | ULRKENKOBAZXFD-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 87.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.94 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |