C21H26N2O2S — CID 143126047
5-[5-[2-(benzenesulfonyl)ethyl]-1H-indol-3-yl]pentan-1-amine (PubChem CID 143126047) has the molecular formula C21H26N2O2S and a molecular weight of 370.52 g/mol. Its IUPAC name is 5-[5-[2-(benzenesulfonyl)ethyl]-1H-indol-3-yl]pentan-1-amine.
| Compound Name | 5-[5-[2-(benzenesulfonyl)ethyl]-1H-indol-3-yl]pentan-1-amine |
|---|---|
| PubChem CID | 143126047 |
| Molecular Formula | C21H26N2O2S |
| Molecular Weight | 370.52 g/mol |
| Exact Mass | 370.17 |
| IUPAC Name | 5-[5-[2-(benzenesulfonyl)ethyl]-1H-indol-3-yl]pentan-1-amine |
| SMILES | NCCCCCc1c[nH]c2ccc(CCS(=O)(=O)c3ccccc3)cc12 |
| InChI | InChI=1S/C21H26N2O2S/c22-13-6-2-3-7-18-16-23-21-11-10-17(15-20(18)21)12-14-26(24,25)19-8-4-1-5-9-19/h1,4-5,8-11,15-16,23H,2-3,6-7,12-14,22H2 |
| InChIKey | KYPCJDGDGKJKTD-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 75.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.52 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|