C16H16N2O2S — CID 11358502
2-[5-(benzenesulfonyl)-1H-indol-3-yl]ethanamine (PubChem CID 11358502) has the molecular formula C16H16N2O2S and a molecular weight of 300.38 g/mol. Its IUPAC name is 2-[5-(benzenesulfonyl)-1H-indol-3-yl]ethanamine.
| Compound Name | 2-[5-(benzenesulfonyl)-1H-indol-3-yl]ethanamine |
|---|---|
| PubChem CID | 11358502 |
| Molecular Formula | C16H16N2O2S |
| Molecular Weight | 300.38 g/mol |
| Exact Mass | 300.09 |
| IUPAC Name | 2-[5-(benzenesulfonyl)-1H-indol-3-yl]ethanamine |
| SMILES | NCCc1c[nH]c2ccc(S(=O)(=O)c3ccccc3)cc12 |
| InChI | InChI=1S/C16H16N2O2S/c17-9-8-12-11-18-16-7-6-14(10-15(12)16)21(19,20)13-4-2-1-3-5-13/h1-7,10-11,18H,8-9,17H2 |
| InChIKey | XRJTXMUXFPOSCS-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 75.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.38 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |