C21H24N2O4S — CID 10135626
tert-butyl N-[2-[5-(benzenesulfonyl)-1H-indol-3-yl]ethyl]carbamate (PubChem CID 10135626) has the molecular formula C21H24N2O4S and a molecular weight of 400.50 g/mol. Its IUPAC name is tert-butyl N-[2-[5-(benzenesulfonyl)-1H-indol-3-yl]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[5-(benzenesulfonyl)-1H-indol-3-yl]ethyl]carbamate |
|---|---|
| PubChem CID | 10135626 |
| Molecular Formula | C21H24N2O4S |
| Molecular Weight | 400.50 g/mol |
| Exact Mass | 400.15 |
| IUPAC Name | tert-butyl N-[2-[5-(benzenesulfonyl)-1H-indol-3-yl]ethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCc1c[nH]c2ccc(S(=O)(=O)c3ccccc3)cc12 |
| InChI | InChI=1S/C21H24N2O4S/c1-21(2,3)27-20(24)22-12-11-15-14-23-19-10-9-17(13-18(15)19)28(25,26)16-7-5-4-6-8-16/h4-10,13-14,23H,11-12H2,1-3H3,(H,22,24) |
| InChIKey | DJNPSJIAUHAEOX-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 88.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.50 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |