C23H28N2O4S — CID 10274190
tert-butyl N-[2-[5-(benzenesulfonyl)-1,2-dimethylindol-3-yl]ethyl]carbamate (PubChem CID 10274190) has the molecular formula C23H28N2O4S and a molecular weight of 428.55 g/mol. Its IUPAC name is tert-butyl N-[2-[5-(benzenesulfonyl)-1,2-dimethylindol-3-yl]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[5-(benzenesulfonyl)-1,2-dimethylindol-3-yl]ethyl]carbamate |
|---|---|
| PubChem CID | 10274190 |
| Molecular Formula | C23H28N2O4S |
| Molecular Weight | 428.55 g/mol |
| Exact Mass | 428.18 |
| IUPAC Name | tert-butyl N-[2-[5-(benzenesulfonyl)-1,2-dimethylindol-3-yl]ethyl]carbamate |
| SMILES | Cc1c(CCNC(=O)OC(C)(C)C)c2cc(S(=O)(=O)c3ccccc3)ccc2n1C |
| InChI | InChI=1S/C23H28N2O4S/c1-16-19(13-14-24-22(26)29-23(2,3)4)20-15-18(11-12-21(20)25(16)5)30(27,28)17-9-7-6-8-10-17/h6-12,15H,13-14H2,1-5H3,(H,24,26) |
| InChIKey | GPSPPHXFEULOET-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 77.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.55 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|