C23H28N2O4S — CID 10137433
tert-butyl N-[2-[1-methyl-5-(4-methylphenyl)sulfonylindol-3-yl]ethyl]carbamate (PubChem CID 10137433) has the molecular formula C23H28N2O4S and a molecular weight of 428.55 g/mol. Its IUPAC name is tert-butyl N-[2-[1-methyl-5-(4-methylphenyl)sulfonylindol-3-yl]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[1-methyl-5-(4-methylphenyl)sulfonylindol-3-yl]ethyl]carbamate |
|---|---|
| PubChem CID | 10137433 |
| Molecular Formula | C23H28N2O4S |
| Molecular Weight | 428.55 g/mol |
| Exact Mass | 428.18 |
| IUPAC Name | tert-butyl N-[2-[1-methyl-5-(4-methylphenyl)sulfonylindol-3-yl]ethyl]carbamate |
| SMILES | Cc1ccc(S(=O)(=O)c2ccc3c(c2)c(CCNC(=O)OC(C)(C)C)cn3C)cc1 |
| InChI | InChI=1S/C23H28N2O4S/c1-16-6-8-18(9-7-16)30(27,28)19-10-11-21-20(14-19)17(15-25(21)5)12-13-24-22(26)29-23(2,3)4/h6-11,14-15H,12-13H2,1-5H3,(H,24,26) |
| InChIKey | UCVVFURIFUWEPD-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 77.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.55 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |