C22H24N2O6S — CID 10837008
tert-butyl N-[2-[1-(4-methylphenyl)sulfonyl-4,7-dioxoindol-3-yl]ethyl]carbamate (PubChem CID 10837008) has the molecular formula C22H24N2O6S and a molecular weight of 444.51 g/mol. Its IUPAC name is tert-butyl N-[2-[1-(4-methylphenyl)sulfonyl-4,7-dioxoindol-3-yl]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[1-(4-methylphenyl)sulfonyl-4,7-dioxoindol-3-yl]ethyl]carbamate |
|---|---|
| PubChem CID | 10837008 |
| Molecular Formula | C22H24N2O6S |
| Molecular Weight | 444.51 g/mol |
| Exact Mass | 444.14 |
| IUPAC Name | tert-butyl N-[2-[1-(4-methylphenyl)sulfonyl-4,7-dioxoindol-3-yl]ethyl]carbamate |
| SMILES | Cc1ccc(S(=O)(=O)n2cc(CCNC(=O)OC(C)(C)C)c3c2C(=O)C=CC3=O)cc1 |
| InChI | InChI=1S/C22H24N2O6S/c1-14-5-7-16(8-6-14)31(28,29)24-13-15(11-12-23-21(27)30-22(2,3)4)19-17(25)9-10-18(26)20(19)24/h5-10,13H,11-12H2,1-4H3,(H,23,27) |
| InChIKey | UVQCXYUEZDIZLF-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 111.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.51 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|