C20H17F3N2O6S — CID 15528180
2,2,2-trifluoro-N-[2-[6-methoxy-1-(4-methylphenyl)sulfonyl-4,7-dioxoindol-3-yl]ethyl]acetamide (PubChem CID 15528180) has the molecular formula C20H17F3N2O6S and a molecular weight of 470.43 g/mol. Its IUPAC name is 2,2,2-trifluoro-N-[2-[6-methoxy-1-(4-methylphenyl)sulfonyl-4,7-dioxoindol-3-yl]ethyl]acetamide.
| Compound Name | 2,2,2-trifluoro-N-[2-[6-methoxy-1-(4-methylphenyl)sulfonyl-4,7-dioxoindol-3-yl]ethyl]acetamide |
|---|---|
| PubChem CID | 15528180 |
| Molecular Formula | C20H17F3N2O6S |
| Molecular Weight | 470.43 g/mol |
| Exact Mass | 470.08 |
| IUPAC Name | 2,2,2-trifluoro-N-[2-[6-methoxy-1-(4-methylphenyl)sulfonyl-4,7-dioxoindol-3-yl]ethyl]acetamide |
| SMILES | COC1=CC(=O)c2c(CCNC(=O)C(F)(F)F)cn(S(=O)(=O)c3ccc(C)cc3)c2C1=O |
| InChI | InChI=1S/C20H17F3N2O6S/c1-11-3-5-13(6-4-11)32(29,30)25-10-12(7-8-24-19(28)20(21,22)23)16-14(26)9-15(31-2)18(27)17(16)25/h3-6,9-10H,7-8H2,1-2H3,(H,24,28) |
| InChIKey | GMSUEDOZKJPNLM-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 111.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.43 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|