C21H23BrN2O4S — CID 23657541
tert-butyl N-[2-[1-(2-bromophenyl)sulfonylindol-3-yl]ethyl]carbamate (PubChem CID 23657541) has the molecular formula C21H23BrN2O4S and a molecular weight of 479.40 g/mol. Its IUPAC name is tert-butyl N-[2-[1-(2-bromophenyl)sulfonylindol-3-yl]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[1-(2-bromophenyl)sulfonylindol-3-yl]ethyl]carbamate |
|---|---|
| PubChem CID | 23657541 |
| Molecular Formula | C21H23BrN2O4S |
| Molecular Weight | 479.40 g/mol |
| Exact Mass | 478.06 |
| IUPAC Name | tert-butyl N-[2-[1-(2-bromophenyl)sulfonylindol-3-yl]ethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCc1cn(S(=O)(=O)c2ccccc2Br)c2ccccc12 |
| InChI | InChI=1S/C21H23BrN2O4S/c1-21(2,3)28-20(25)23-13-12-15-14-24(18-10-6-4-8-16(15)18)29(26,27)19-11-7-5-9-17(19)22/h4-11,14H,12-13H2,1-3H3,(H,23,25) |
| InChIKey | IEVCEMHPJJDYDT-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 77.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.40 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |