C23H28N2O6S — CID 23655114
tert-butyl N-[2-[1-(3,4-dimethoxyphenyl)sulfonylindol-3-yl]ethyl]carbamate (PubChem CID 23655114) has the molecular formula C23H28N2O6S and a molecular weight of 460.55 g/mol. Its IUPAC name is tert-butyl N-[2-[1-(3,4-dimethoxyphenyl)sulfonylindol-3-yl]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[1-(3,4-dimethoxyphenyl)sulfonylindol-3-yl]ethyl]carbamate |
|---|---|
| PubChem CID | 23655114 |
| Molecular Formula | C23H28N2O6S |
| Molecular Weight | 460.55 g/mol |
| Exact Mass | 460.17 |
| IUPAC Name | tert-butyl N-[2-[1-(3,4-dimethoxyphenyl)sulfonylindol-3-yl]ethyl]carbamate |
| SMILES | COc1ccc(S(=O)(=O)n2cc(CCNC(=O)OC(C)(C)C)c3ccccc32)cc1OC |
| InChI | InChI=1S/C23H28N2O6S/c1-23(2,3)31-22(26)24-13-12-16-15-25(19-9-7-6-8-18(16)19)32(27,28)17-10-11-20(29-4)21(14-17)30-5/h6-11,14-15H,12-13H2,1-5H3,(H,24,26) |
| InChIKey | JSZOOWMBPAXQFL-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.55 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |