C19H21N5O4S — CID 10001896
2-[(Z)-1-[1-(3,4-dimethoxyphenyl)sulfonylindol-3-yl]ethylideneamino]guanidine (PubChem CID 10001896) has the molecular formula C19H21N5O4S and a molecular weight of 415.48 g/mol. Its IUPAC name is 2-[(Z)-1-[1-(3,4-dimethoxyphenyl)sulfonylindol-3-yl]ethylideneamino]guanidine.
| Compound Name | 2-[(Z)-1-[1-(3,4-dimethoxyphenyl)sulfonylindol-3-yl]ethylideneamino]guanidine |
|---|---|
| PubChem CID | 10001896 |
| Molecular Formula | C19H21N5O4S |
| Molecular Weight | 415.48 g/mol |
| Exact Mass | 415.13 |
| IUPAC Name | 2-[(Z)-1-[1-(3,4-dimethoxyphenyl)sulfonylindol-3-yl]ethylideneamino]guanidine |
| SMILES | COc1ccc(S(=O)(=O)n2cc(/C(C)=N\N=C(N)N)c3ccccc32)cc1OC |
| InChI | InChI=1S/C19H21N5O4S/c1-12(22-23-19(20)21)15-11-24(16-7-5-4-6-14(15)16)29(25,26)13-8-9-17(27-2)18(10-13)28-3/h4-11H,1-3H3,(H4,20,21,23)/b22-12- |
| InChIKey | BJAOQRLRXWIAJD-UUYOSTAYSA-N |
| XLogP | 1.89 |
| TPSA | 134.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.48 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|