C21H23N5O4S — CID 22394667
2-[(E)-[cyclopropyl-[1-(3,4-dimethoxyphenyl)sulfonylindol-3-yl]methylidene]amino]guanidine (PubChem CID 22394667) has the molecular formula C21H23N5O4S and a molecular weight of 441.51 g/mol. Its IUPAC name is 2-[(E)-[cyclopropyl-[1-(3,4-dimethoxyphenyl)sulfonylindol-3-yl]methylidene]amino]guanidine.
| Compound Name | 2-[(E)-[cyclopropyl-[1-(3,4-dimethoxyphenyl)sulfonylindol-3-yl]methylidene]amino]guanidine |
|---|---|
| PubChem CID | 22394667 |
| Molecular Formula | C21H23N5O4S |
| Molecular Weight | 441.51 g/mol |
| Exact Mass | 441.15 |
| IUPAC Name | 2-[(E)-[cyclopropyl-[1-(3,4-dimethoxyphenyl)sulfonylindol-3-yl]methylidene]amino]guanidine |
| SMILES | COc1ccc(S(=O)(=O)n2cc(/C(=N/N=C(N)N)C3CC3)c3ccccc32)cc1OC |
| InChI | InChI=1S/C21H23N5O4S/c1-29-18-10-9-14(11-19(18)30-2)31(27,28)26-12-16(15-5-3-4-6-17(15)26)20(13-7-8-13)24-25-21(22)23/h3-6,9-13H,7-8H2,1-2H3,(H4,22,23,25)/b24-20+ |
| InChIKey | RRRAUMXRYWXGIO-HIXSDJFHSA-N |
| XLogP | 2.28 |
| TPSA | 134.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.51 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|