C23H20ClN5O2S — CID 87970516
2-[(Z)-[(5-chloro-1-naphthalen-2-ylsulfonylindol-3-yl)-cyclopropylmethylidene]amino]guanidine (PubChem CID 87970516) has the molecular formula C23H20ClN5O2S and a molecular weight of 465.97 g/mol. Its IUPAC name is 2-[(Z)-[(5-chloro-1-naphthalen-2-ylsulfonylindol-3-yl)-cyclopropylmethylidene]amino]guanidine.
| Compound Name | 2-[(Z)-[(5-chloro-1-naphthalen-2-ylsulfonylindol-3-yl)-cyclopropylmethylidene]amino]guanidine |
|---|---|
| PubChem CID | 87970516 |
| Molecular Formula | C23H20ClN5O2S |
| Molecular Weight | 465.97 g/mol |
| Exact Mass | 465.10 |
| IUPAC Name | 2-[(Z)-[(5-chloro-1-naphthalen-2-ylsulfonylindol-3-yl)-cyclopropylmethylidene]amino]guanidine |
| SMILES | NC(N)=N/N=C(\c1cn(S(=O)(=O)c2ccc3ccccc3c2)c2ccc(Cl)cc12)C1CC1 |
| InChI | InChI=1S/C23H20ClN5O2S/c24-17-8-10-21-19(12-17)20(22(15-5-6-15)27-28-23(25)26)13-29(21)32(30,31)18-9-7-14-3-1-2-4-16(14)11-18/h1-4,7-13,15H,5-6H2,(H4,25,26,28)/b27-22- |
| InChIKey | SVSUPXDJNUIYNB-QYQHSDTDSA-N |
| XLogP | 4.07 |
| TPSA | 115.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.97 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|