C22H20FN5O2S — CID 73082585
2-[1-(5-fluoro-1-naphthalen-2-ylsulfonylindol-3-yl)propylideneamino]guanidine (PubChem CID 73082585) has the molecular formula C22H20FN5O2S and a molecular weight of 437.50 g/mol. Its IUPAC name is 2-[1-(5-fluoro-1-naphthalen-2-ylsulfonylindol-3-yl)propylideneamino]guanidine.
| Compound Name | 2-[1-(5-fluoro-1-naphthalen-2-ylsulfonylindol-3-yl)propylideneamino]guanidine |
|---|---|
| PubChem CID | 73082585 |
| Molecular Formula | C22H20FN5O2S |
| Molecular Weight | 437.50 g/mol |
| Exact Mass | 437.13 |
| IUPAC Name | 2-[1-(5-fluoro-1-naphthalen-2-ylsulfonylindol-3-yl)propylideneamino]guanidine |
| SMILES | CCC(=NN=C(N)N)c1cn(S(=O)(=O)c2ccc3ccccc3c2)c2ccc(F)cc12 |
| InChI | InChI=1S/C22H20FN5O2S/c1-2-20(26-27-22(24)25)19-13-28(21-10-8-16(23)12-18(19)21)31(29,30)17-9-7-14-5-3-4-6-15(14)11-17/h3-13H,2H2,1H3,(H4,24,25,27) |
| InChIKey | VDUADQSPBISHFB-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 115.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.50 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|