C24H25N5O2S — CID 87969673
2-[(E)-1-(1-naphthalen-2-ylsulfonylindol-3-yl)pentylideneamino]guanidine (PubChem CID 87969673) has the molecular formula C24H25N5O2S and a molecular weight of 447.56 g/mol. Its IUPAC name is 2-[(E)-1-(1-naphthalen-2-ylsulfonylindol-3-yl)pentylideneamino]guanidine.
| Compound Name | 2-[(E)-1-(1-naphthalen-2-ylsulfonylindol-3-yl)pentylideneamino]guanidine |
|---|---|
| PubChem CID | 87969673 |
| Molecular Formula | C24H25N5O2S |
| Molecular Weight | 447.56 g/mol |
| Exact Mass | 447.17 |
| IUPAC Name | 2-[(E)-1-(1-naphthalen-2-ylsulfonylindol-3-yl)pentylideneamino]guanidine |
| SMILES | CCCC/C(=N\N=C(N)N)c1cn(S(=O)(=O)c2ccc3ccccc3c2)c2ccccc12 |
| InChI | InChI=1S/C24H25N5O2S/c1-2-3-11-22(27-28-24(25)26)21-16-29(23-12-7-6-10-20(21)23)32(30,31)19-14-13-17-8-4-5-9-18(17)15-19/h4-10,12-16H,2-3,11H2,1H3,(H4,25,26,28)/b27-22+ |
| InChIKey | UVZQPQFNTWCSRU-HPNDGRJYSA-N |
| XLogP | 4.20 |
| TPSA | 115.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.56 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|