C21H22FNO5S — CID 86673691
tert-butyl N-[2-[5-(3-fluorophenyl)sulfonyl-1-benzofuran-3-yl]ethyl]carbamate (PubChem CID 86673691) has the molecular formula C21H22FNO5S and a molecular weight of 419.47 g/mol. Its IUPAC name is tert-butyl N-[2-[5-(3-fluorophenyl)sulfonyl-1-benzofuran-3-yl]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[5-(3-fluorophenyl)sulfonyl-1-benzofuran-3-yl]ethyl]carbamate |
|---|---|
| PubChem CID | 86673691 |
| Molecular Formula | C21H22FNO5S |
| Molecular Weight | 419.47 g/mol |
| Exact Mass | 419.12 |
| IUPAC Name | tert-butyl N-[2-[5-(3-fluorophenyl)sulfonyl-1-benzofuran-3-yl]ethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCc1coc2ccc(S(=O)(=O)c3cccc(F)c3)cc12 |
| InChI | InChI=1S/C21H22FNO5S/c1-21(2,3)28-20(24)23-10-9-14-13-27-19-8-7-17(12-18(14)19)29(25,26)16-6-4-5-15(22)11-16/h4-8,11-13H,9-10H2,1-3H3,(H,23,24) |
| InChIKey | ZJZVLLQXYFRKNQ-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 85.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.47 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |