C27H34BNO5 — CID 156725453
tert-butyl N-[[3-[3-[(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methyl]-1-benzofuran-5-yl]phenyl]methyl]carbamate (PubChem CID 156725453) has the molecular formula C27H34BNO5 and a molecular weight of 463.38 g/mol. Its IUPAC name is tert-butyl N-[[3-[3-[(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methyl]-1-benzofuran-5-yl]phenyl]methyl]carbamate.
| Compound Name | tert-butyl N-[[3-[3-[(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methyl]-1-benzofuran-5-yl]phenyl]methyl]carbamate |
|---|---|
| PubChem CID | 156725453 |
| Molecular Formula | C27H34BNO5 |
| Molecular Weight | 463.38 g/mol |
| Exact Mass | 463.25 |
| IUPAC Name | tert-butyl N-[[3-[3-[(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methyl]-1-benzofuran-5-yl]phenyl]methyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCc1cccc(-c2ccc3occ(CB4OC(C)(C)C(C)(C)O4)c3c2)c1 |
| InChI | InChI=1S/C27H34BNO5/c1-25(2,3)32-24(30)29-16-18-9-8-10-19(13-18)20-11-12-23-22(14-20)21(17-31-23)15-28-33-26(4,5)27(6,7)34-28/h8-14,17H,15-16H2,1-7H3,(H,29,30) |
| InChIKey | AYTYPZGKDJTQBO-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 69.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.38 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|