C25H32N2O5S — CID 10162393
tert-butyl N-[2-[5-(3-methoxyphenyl)sulfonyl-1,2-dimethylindol-3-yl]ethyl]-N-methylcarbamate (PubChem CID 10162393) has the molecular formula C25H32N2O5S and a molecular weight of 472.61 g/mol. Its IUPAC name is tert-butyl N-[2-[5-(3-methoxyphenyl)sulfonyl-1,2-dimethylindol-3-yl]ethyl]-N-methylcarbamate.
| Compound Name | tert-butyl N-[2-[5-(3-methoxyphenyl)sulfonyl-1,2-dimethylindol-3-yl]ethyl]-N-methylcarbamate |
|---|---|
| PubChem CID | 10162393 |
| Molecular Formula | C25H32N2O5S |
| Molecular Weight | 472.61 g/mol |
| Exact Mass | 472.20 |
| IUPAC Name | tert-butyl N-[2-[5-(3-methoxyphenyl)sulfonyl-1,2-dimethylindol-3-yl]ethyl]-N-methylcarbamate |
| SMILES | COc1cccc(S(=O)(=O)c2ccc3c(c2)c(CCN(C)C(=O)OC(C)(C)C)c(C)n3C)c1 |
| InChI | InChI=1S/C25H32N2O5S/c1-17-21(13-14-26(5)24(28)32-25(2,3)4)22-16-20(11-12-23(22)27(17)6)33(29,30)19-10-8-9-18(15-19)31-7/h8-12,15-16H,13-14H2,1-7H3 |
| InChIKey | ODKDLRLZJGZOIX-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 77.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.61 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|