C19H23NO5S — CID 70074555
tert-butyl N-(4-methoxyphenyl)sulfonyl-N-(3-methylphenyl)carbamate (PubChem CID 70074555) has the molecular formula C19H23NO5S and a molecular weight of 377.46 g/mol. Its IUPAC name is tert-butyl N-(4-methoxyphenyl)sulfonyl-N-(3-methylphenyl)carbamate.
| Compound Name | tert-butyl N-(4-methoxyphenyl)sulfonyl-N-(3-methylphenyl)carbamate |
|---|---|
| PubChem CID | 70074555 |
| Molecular Formula | C19H23NO5S |
| Molecular Weight | 377.46 g/mol |
| Exact Mass | 377.13 |
| IUPAC Name | tert-butyl N-(4-methoxyphenyl)sulfonyl-N-(3-methylphenyl)carbamate |
| SMILES | COc1ccc(S(=O)(=O)N(C(=O)OC(C)(C)C)c2cccc(C)c2)cc1 |
| InChI | InChI=1S/C19H23NO5S/c1-14-7-6-8-15(13-14)20(18(21)25-19(2,3)4)26(22,23)17-11-9-16(24-5)10-12-17/h6-13H,1-5H3 |
| InChIKey | RAHBBYNQFIJBJT-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.46 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |