C22H26INO4S — CID 156812612
tert-butyl N-(benzenesulfonyl)-N-[3-[(E)-5-iodopent-1-enyl]phenyl]carbamate (PubChem CID 156812612) has the molecular formula C22H26INO4S and a molecular weight of 527.42 g/mol. Its IUPAC name is tert-butyl N-(benzenesulfonyl)-N-[3-[(E)-5-iodopent-1-enyl]phenyl]carbamate.
| Compound Name | tert-butyl N-(benzenesulfonyl)-N-[3-[(E)-5-iodopent-1-enyl]phenyl]carbamate |
|---|---|
| PubChem CID | 156812612 |
| Molecular Formula | C22H26INO4S |
| Molecular Weight | 527.42 g/mol |
| Exact Mass | 527.06 |
| IUPAC Name | tert-butyl N-(benzenesulfonyl)-N-[3-[(E)-5-iodopent-1-enyl]phenyl]carbamate |
| SMILES | CC(C)(C)OC(=O)N(c1cccc(/C=C/CCCI)c1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C22H26INO4S/c1-22(2,3)28-21(25)24(29(26,27)20-14-7-4-8-15-20)19-13-10-12-18(17-19)11-6-5-9-16-23/h4,6-8,10-15,17H,5,9,16H2,1-3H3/b11-6+ |
| InChIKey | KMSXSAPDJSDEBW-IZZDOVSWSA-N |
| XLogP | 6.05 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.42 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|