C18H27N3O2 — CID 107241393
tert-butyl N-[2-[(1,3-dimethylindol-2-yl)methylamino]ethyl]carbamate (PubChem CID 107241393) has the molecular formula C18H27N3O2 and a molecular weight of 317.43 g/mol. Its IUPAC name is tert-butyl N-[2-[(1,3-dimethylindol-2-yl)methylamino]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[(1,3-dimethylindol-2-yl)methylamino]ethyl]carbamate |
|---|---|
| PubChem CID | 107241393 |
| Molecular Formula | C18H27N3O2 |
| Molecular Weight | 317.43 g/mol |
| Exact Mass | 317.21 |
| IUPAC Name | tert-butyl N-[2-[(1,3-dimethylindol-2-yl)methylamino]ethyl]carbamate |
| SMILES | Cc1c(CNCCNC(=O)OC(C)(C)C)n(C)c2ccccc12 |
| InChI | InChI=1S/C18H27N3O2/c1-13-14-8-6-7-9-15(14)21(5)16(13)12-19-10-11-20-17(22)23-18(2,3)4/h6-9,19H,10-12H2,1-5H3,(H,20,22) |
| InChIKey | SKRIJEQSMNGGRC-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 55.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.43 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|