C18H28N2O — CID 107236210
3-butoxy-N-[(1,3-dimethylindol-2-yl)methyl]propan-1-amine (PubChem CID 107236210) has the molecular formula C18H28N2O and a molecular weight of 288.44 g/mol. Its IUPAC name is 3-butoxy-N-[(1,3-dimethylindol-2-yl)methyl]propan-1-amine.
| Compound Name | 3-butoxy-N-[(1,3-dimethylindol-2-yl)methyl]propan-1-amine |
|---|---|
| PubChem CID | 107236210 |
| Molecular Formula | C18H28N2O |
| Molecular Weight | 288.44 g/mol |
| Exact Mass | 288.22 |
| IUPAC Name | 3-butoxy-N-[(1,3-dimethylindol-2-yl)methyl]propan-1-amine |
| SMILES | CCCCOCCCNCc1c(C)c2ccccc2n1C |
| InChI | InChI=1S/C18H28N2O/c1-4-5-12-21-13-8-11-19-14-18-15(2)16-9-6-7-10-17(16)20(18)3/h6-7,9-10,19H,4-5,8,11-14H2,1-3H3 |
| InChIKey | CMNXFRDCTSREDY-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 26.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.44 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|