C17H25N3O — CID 107234652
N-[(1,3-dimethylindol-2-yl)methyl]-2-morpholin-4-ylethanamine (PubChem CID 107234652) has the molecular formula C17H25N3O and a molecular weight of 287.41 g/mol. Its IUPAC name is N-[(1,3-dimethylindol-2-yl)methyl]-2-morpholin-4-ylethanamine.
| Compound Name | N-[(1,3-dimethylindol-2-yl)methyl]-2-morpholin-4-ylethanamine |
|---|---|
| PubChem CID | 107234652 |
| Molecular Formula | C17H25N3O |
| Molecular Weight | 287.41 g/mol |
| Exact Mass | 287.20 |
| IUPAC Name | N-[(1,3-dimethylindol-2-yl)methyl]-2-morpholin-4-ylethanamine |
| SMILES | Cc1c(CNCCN2CCOCC2)n(C)c2ccccc12 |
| InChI | InChI=1S/C17H25N3O/c1-14-15-5-3-4-6-16(15)19(2)17(14)13-18-7-8-20-9-11-21-12-10-20/h3-6,18H,7-13H2,1-2H3 |
| InChIKey | MEAWELKWCSPCAU-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 29.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.41 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|