C17H25N3O — CID 107235570
3-[(1,3-dimethylindol-2-yl)methylamino]-N-propylpropanamide (PubChem CID 107235570) has the molecular formula C17H25N3O and a molecular weight of 287.41 g/mol. Its IUPAC name is 3-[(1,3-dimethylindol-2-yl)methylamino]-N-propylpropanamide.
| Compound Name | 3-[(1,3-dimethylindol-2-yl)methylamino]-N-propylpropanamide |
|---|---|
| PubChem CID | 107235570 |
| Molecular Formula | C17H25N3O |
| Molecular Weight | 287.41 g/mol |
| Exact Mass | 287.20 |
| IUPAC Name | 3-[(1,3-dimethylindol-2-yl)methylamino]-N-propylpropanamide |
| SMILES | CCCNC(=O)CCNCc1c(C)c2ccccc2n1C |
| InChI | InChI=1S/C17H25N3O/c1-4-10-19-17(21)9-11-18-12-16-13(2)14-7-5-6-8-15(14)20(16)3/h5-8,18H,4,9-12H2,1-3H3,(H,19,21) |
| InChIKey | KGTGRHSTVSWLPO-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 46.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.41 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|