C14H20N2O2 — CID 107235824
2-[(1,3-dimethylindol-2-yl)methylamino]propane-1,3-diol (PubChem CID 107235824) has the molecular formula C14H20N2O2 and a molecular weight of 248.33 g/mol. Its IUPAC name is 2-[(1,3-dimethylindol-2-yl)methylamino]propane-1,3-diol.
| Compound Name | 2-[(1,3-dimethylindol-2-yl)methylamino]propane-1,3-diol |
|---|---|
| PubChem CID | 107235824 |
| Molecular Formula | C14H20N2O2 |
| Molecular Weight | 248.33 g/mol |
| Exact Mass | 248.15 |
| IUPAC Name | 2-[(1,3-dimethylindol-2-yl)methylamino]propane-1,3-diol |
| SMILES | Cc1c(CNC(CO)CO)n(C)c2ccccc12 |
| InChI | InChI=1S/C14H20N2O2/c1-10-12-5-3-4-6-13(12)16(2)14(10)7-15-11(8-17)9-18/h3-6,11,15,17-18H,7-9H2,1-2H3 |
| InChIKey | NZGNHQUALAATRY-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 57.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.33 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|