C18H26N2 — CID 107235986
(1S)-1-cyclopentyl-N-[(1,3-dimethylindol-2-yl)methyl]ethanamine (PubChem CID 107235986) has the molecular formula C18H26N2 and a molecular weight of 270.42 g/mol. Its IUPAC name is (1S)-1-cyclopentyl-N-[(1,3-dimethylindol-2-yl)methyl]ethanamine.
| Compound Name | (1S)-1-cyclopentyl-N-[(1,3-dimethylindol-2-yl)methyl]ethanamine |
|---|---|
| PubChem CID | 107235986 |
| Molecular Formula | C18H26N2 |
| Molecular Weight | 270.42 g/mol |
| Exact Mass | 270.21 |
| IUPAC Name | (1S)-1-cyclopentyl-N-[(1,3-dimethylindol-2-yl)methyl]ethanamine |
| SMILES | Cc1c(CN[C@@H](C)C2CCCC2)n(C)c2ccccc12 |
| InChI | InChI=1S/C18H26N2/c1-13-16-10-6-7-11-17(16)20(3)18(13)12-19-14(2)15-8-4-5-9-15/h6-7,10-11,14-15,19H,4-5,8-9,12H2,1-3H3/t14-/m0/s1 |
| InChIKey | PXZZEIGICFHATI-AWEZNQCLSA-N |
| XLogP | 4.16 |
| TPSA | 16.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.42 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|