About 2,2-dicyclopropyl-N-[(1,3-dimethylindol-2-yl)methyl]ethanamine
2,2-dicyclopropyl-N-[(1,3-dimethylindol-2-yl)methyl]ethanamine (PubChem CID 107235840) has the molecular formula C19H26N2
and a molecular weight of 282.43 g/mol. Its IUPAC name is 2,2-dicyclopropyl-N-[(1,3-dimethylindol-2-yl)methyl]ethanamine.
Molecular Properties
| Compound Name | 2,2-dicyclopropyl-N-[(1,3-dimethylindol-2-yl)methyl]ethanamine |
| PubChem CID | 107235840 |
| Molecular Formula | C19H26N2 |
| Molecular Weight | 282.43 g/mol |
| Exact Mass | 282.21 |
| IUPAC Name | 2,2-dicyclopropyl-N-[(1,3-dimethylindol-2-yl)methyl]ethanamine |
| SMILES | Cc1c(CNCC(C2CC2)C2CC2)n(C)c2ccccc12 |
| InChI | InChI=1S/C19H26N2/c1-13-16-5-3-4-6-18(16)21(2)19(13)12-20-11-17(14-7-8-14)15-9-10-15/h3-6,14-15,17,20H,7-12H2,1-2H3 |
| InChIKey | LCEULARIMLVIST-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 16.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.43 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|
Analyze 2,2-dicyclopropyl-N-[(1,3-dimethylindol-2-yl)methyl]ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-dicyclopropyl-N-[(1,3-dimethylindol-2-yl)methyl]ethanamine?
The IUPAC name of 2,2-dicyclopropyl-N-[(1,3-dimethylindol-2-yl)methyl]ethanamine (CID 107235840) is 2,2-dicyclopropyl-N-[(1,3-dimethylindol-2-yl)methyl]ethanamine.
What is the SMILES notation for 2,2-dicyclopropyl-N-[(1,3-dimethylindol-2-yl)methyl]ethanamine?
The canonical SMILES for 2,2-dicyclopropyl-N-[(1,3-dimethylindol-2-yl)methyl]ethanamine is Cc1c(CNCC(C2CC2)C2CC2)n(C)c2ccccc12.
What is the InChIKey of 2,2-dicyclopropyl-N-[(1,3-dimethylindol-2-yl)methyl]ethanamine?
The InChIKey is LCEULARIMLVIST-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H26N2/c1-13-16-5-3-4-6-18(16)21(2)19(13)12-20-11-17(14-7-8-14)15-9-10-15/h3-6,14-15,17,20H,7-12H2,1-2H3.
What are the key properties of 2,2-dicyclopropyl-N-[(1,3-dimethylindol-2-yl)methyl]ethanamine?
2,2-dicyclopropyl-N-[(1,3-dimethylindol-2-yl)methyl]ethanamine has a molecular weight of 282.43 g/mol, XLogP of 4.01, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-dicyclopropyl-N-[(1,3-dimethylindol-2-yl)methyl]ethanamine is sourced from PubChem (CID 107235840), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).