C17H26N2 — CID 107236351
N-[(1,3-dimethylindol-2-yl)methyl]-2,2-dimethylbutan-1-amine (PubChem CID 107236351) has the molecular formula C17H26N2 and a molecular weight of 258.41 g/mol. Its IUPAC name is N-[(1,3-dimethylindol-2-yl)methyl]-2,2-dimethylbutan-1-amine.
| Compound Name | N-[(1,3-dimethylindol-2-yl)methyl]-2,2-dimethylbutan-1-amine |
|---|---|
| PubChem CID | 107236351 |
| Molecular Formula | C17H26N2 |
| Molecular Weight | 258.41 g/mol |
| Exact Mass | 258.21 |
| IUPAC Name | N-[(1,3-dimethylindol-2-yl)methyl]-2,2-dimethylbutan-1-amine |
| SMILES | CCC(C)(C)CNCc1c(C)c2ccccc2n1C |
| InChI | InChI=1S/C17H26N2/c1-6-17(3,4)12-18-11-16-13(2)14-9-7-8-10-15(14)19(16)5/h7-10,18H,6,11-12H2,1-5H3 |
| InChIKey | CRQFHJGOPFBGQB-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 16.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.41 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|