C17H26N2O — CID 107235809
3-[[(1,3-dimethylindol-2-yl)methylamino]methyl]pentan-3-ol (PubChem CID 107235809) has the molecular formula C17H26N2O and a molecular weight of 274.41 g/mol. Its IUPAC name is 3-[[(1,3-dimethylindol-2-yl)methylamino]methyl]pentan-3-ol.
| Compound Name | 3-[[(1,3-dimethylindol-2-yl)methylamino]methyl]pentan-3-ol |
|---|---|
| PubChem CID | 107235809 |
| Molecular Formula | C17H26N2O |
| Molecular Weight | 274.41 g/mol |
| Exact Mass | 274.20 |
| IUPAC Name | 3-[[(1,3-dimethylindol-2-yl)methylamino]methyl]pentan-3-ol |
| SMILES | CCC(O)(CC)CNCc1c(C)c2ccccc2n1C |
| InChI | InChI=1S/C17H26N2O/c1-5-17(20,6-2)12-18-11-16-13(3)14-9-7-8-10-15(14)19(16)4/h7-10,18,20H,5-6,11-12H2,1-4H3 |
| InChIKey | ZVGJEWKYHJNXDI-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 37.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.41 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|