C18H19BrN2 — CID 107234683
1-(4-bromophenyl)-N-[(1,3-dimethylindol-2-yl)methyl]methanamine (PubChem CID 107234683) has the molecular formula C18H19BrN2 and a molecular weight of 343.27 g/mol. Its IUPAC name is 1-(4-bromophenyl)-N-[(1,3-dimethylindol-2-yl)methyl]methanamine.
| Compound Name | 1-(4-bromophenyl)-N-[(1,3-dimethylindol-2-yl)methyl]methanamine |
|---|---|
| PubChem CID | 107234683 |
| Molecular Formula | C18H19BrN2 |
| Molecular Weight | 343.27 g/mol |
| Exact Mass | 342.07 |
| IUPAC Name | 1-(4-bromophenyl)-N-[(1,3-dimethylindol-2-yl)methyl]methanamine |
| SMILES | Cc1c(CNCc2ccc(Br)cc2)n(C)c2ccccc12 |
| InChI | InChI=1S/C18H19BrN2/c1-13-16-5-3-4-6-17(16)21(2)18(13)12-20-11-14-7-9-15(19)10-8-14/h3-10,20H,11-12H2,1-2H3 |
| InChIKey | LIZCMOIFRMOQPV-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 16.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.27 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|