C16H24N2O — CID 107236217
3-[(1,3-dimethylindol-2-yl)methylamino]-2-methylbutan-1-ol (PubChem CID 107236217) has the molecular formula C16H24N2O and a molecular weight of 260.38 g/mol. Its IUPAC name is 3-[(1,3-dimethylindol-2-yl)methylamino]-2-methylbutan-1-ol.
| Compound Name | 3-[(1,3-dimethylindol-2-yl)methylamino]-2-methylbutan-1-ol |
|---|---|
| PubChem CID | 107236217 |
| Molecular Formula | C16H24N2O |
| Molecular Weight | 260.38 g/mol |
| Exact Mass | 260.19 |
| IUPAC Name | 3-[(1,3-dimethylindol-2-yl)methylamino]-2-methylbutan-1-ol |
| SMILES | Cc1c(CNC(C)C(C)CO)n(C)c2ccccc12 |
| InChI | InChI=1S/C16H24N2O/c1-11(10-19)13(3)17-9-16-12(2)14-7-5-6-8-15(14)18(16)4/h5-8,11,13,17,19H,9-10H2,1-4H3 |
| InChIKey | OVUFJGHKVQJCPP-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 37.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.38 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|