C16H23N3O — CID 106095875
3-[(1,3-dimethylindol-2-yl)methylamino]-3-methylbutanamide (PubChem CID 106095875) has the molecular formula C16H23N3O and a molecular weight of 273.38 g/mol. Its IUPAC name is 3-[(1,3-dimethylindol-2-yl)methylamino]-3-methylbutanamide.
| Compound Name | 3-[(1,3-dimethylindol-2-yl)methylamino]-3-methylbutanamide |
|---|---|
| PubChem CID | 106095875 |
| Molecular Formula | C16H23N3O |
| Molecular Weight | 273.38 g/mol |
| Exact Mass | 273.18 |
| IUPAC Name | 3-[(1,3-dimethylindol-2-yl)methylamino]-3-methylbutanamide |
| SMILES | Cc1c(CNC(C)(C)CC(N)=O)n(C)c2ccccc12 |
| InChI | InChI=1S/C16H23N3O/c1-11-12-7-5-6-8-13(12)19(4)14(11)10-18-16(2,3)9-15(17)20/h5-8,18H,9-10H2,1-4H3,(H2,17,20) |
| InChIKey | RHWTZSCJZLIWEZ-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 60.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.38 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|