C18H20N2S — CID 107234573
N-[(1,3-dimethylindol-2-yl)methyl]-4-methylsulfanylaniline (PubChem CID 107234573) has the molecular formula C18H20N2S and a molecular weight of 296.44 g/mol. Its IUPAC name is N-[(1,3-dimethylindol-2-yl)methyl]-4-methylsulfanylaniline.
| Compound Name | N-[(1,3-dimethylindol-2-yl)methyl]-4-methylsulfanylaniline |
|---|---|
| PubChem CID | 107234573 |
| Molecular Formula | C18H20N2S |
| Molecular Weight | 296.44 g/mol |
| Exact Mass | 296.13 |
| IUPAC Name | N-[(1,3-dimethylindol-2-yl)methyl]-4-methylsulfanylaniline |
| SMILES | CSc1ccc(NCc2c(C)c3ccccc3n2C)cc1 |
| InChI | InChI=1S/C18H20N2S/c1-13-16-6-4-5-7-17(16)20(2)18(13)12-19-14-8-10-15(21-3)11-9-14/h4-11,19H,12H2,1-3H3 |
| InChIKey | XNRXHIFBDMKXRS-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 16.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.44 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|