C17H16BrFN2 — CID 107598490
2-bromo-N-[(1,3-dimethylindol-2-yl)methyl]-6-fluoroaniline (PubChem CID 107598490) has the molecular formula C17H16BrFN2 and a molecular weight of 347.23 g/mol. Its IUPAC name is 2-bromo-N-[(1,3-dimethylindol-2-yl)methyl]-6-fluoroaniline.
| Compound Name | 2-bromo-N-[(1,3-dimethylindol-2-yl)methyl]-6-fluoroaniline |
|---|---|
| PubChem CID | 107598490 |
| Molecular Formula | C17H16BrFN2 |
| Molecular Weight | 347.23 g/mol |
| Exact Mass | 346.05 |
| IUPAC Name | 2-bromo-N-[(1,3-dimethylindol-2-yl)methyl]-6-fluoroaniline |
| SMILES | Cc1c(CNc2c(F)cccc2Br)n(C)c2ccccc12 |
| InChI | InChI=1S/C17H16BrFN2/c1-11-12-6-3-4-9-15(12)21(2)16(11)10-20-17-13(18)7-5-8-14(17)19/h3-9,20H,10H2,1-2H3 |
| InChIKey | XVQVMOMDEXQWHD-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 16.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.23 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|