C12H18N4O2S — CID 84760927
N'-[2-(1H-indol-3-yl)ethylsulfamoyl]ethane-1,2-diamine (PubChem CID 84760927) has the molecular formula C12H18N4O2S and a molecular weight of 282.37 g/mol. Its IUPAC name is N'-[2-(1H-indol-3-yl)ethylsulfamoyl]ethane-1,2-diamine.
| Compound Name | N'-[2-(1H-indol-3-yl)ethylsulfamoyl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 84760927 |
| Molecular Formula | C12H18N4O2S |
| Molecular Weight | 282.37 g/mol |
| Exact Mass | 282.12 |
| IUPAC Name | N'-[2-(1H-indol-3-yl)ethylsulfamoyl]ethane-1,2-diamine |
| SMILES | NCCNS(=O)(=O)NCCc1c[nH]c2ccccc12 |
| InChI | InChI=1S/C12H18N4O2S/c13-6-8-16-19(17,18)15-7-5-10-9-14-12-4-2-1-3-11(10)12/h1-4,9,14-16H,5-8,13H2 |
| InChIKey | OCRLYUBGTUWRQL-UHFFFAOYSA-N |
| XLogP | 0.09 |
| TPSA | 100.01 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.37 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |