C16H14F2N2O2S — CID 25035880
2,6-difluoro-N-[2-(1H-indol-3-yl)ethyl]benzenesulfonamide (PubChem CID 25035880) has the molecular formula C16H14F2N2O2S and a molecular weight of 336.36 g/mol. Its IUPAC name is 2,6-difluoro-N-[2-(1H-indol-3-yl)ethyl]benzenesulfonamide.
| Compound Name | 2,6-difluoro-N-[2-(1H-indol-3-yl)ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 25035880 |
| Molecular Formula | C16H14F2N2O2S |
| Molecular Weight | 336.36 g/mol |
| Exact Mass | 336.07 |
| IUPAC Name | 2,6-difluoro-N-[2-(1H-indol-3-yl)ethyl]benzenesulfonamide |
| SMILES | O=S(=O)(NCCc1c[nH]c2ccccc12)c1c(F)cccc1F |
| InChI | InChI=1S/C16H14F2N2O2S/c17-13-5-3-6-14(18)16(13)23(21,22)20-9-8-11-10-19-15-7-2-1-4-12(11)15/h1-7,10,19-20H,8-9H2 |
| InChIKey | RJFCGYCPAOZURX-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 61.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.36 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |