C21H25N3O3S — CID 109062575
N-butyl-3-[2-(1H-indol-3-yl)ethylsulfamoyl]benzamide (PubChem CID 109062575) has the molecular formula C21H25N3O3S and a molecular weight of 399.52 g/mol. Its IUPAC name is N-butyl-3-[2-(1H-indol-3-yl)ethylsulfamoyl]benzamide.
| Compound Name | N-butyl-3-[2-(1H-indol-3-yl)ethylsulfamoyl]benzamide |
|---|---|
| PubChem CID | 109062575 |
| Molecular Formula | C21H25N3O3S |
| Molecular Weight | 399.52 g/mol |
| Exact Mass | 399.16 |
| IUPAC Name | N-butyl-3-[2-(1H-indol-3-yl)ethylsulfamoyl]benzamide |
| SMILES | CCCCNC(=O)c1cccc(S(=O)(=O)NCCc2c[nH]c3ccccc23)c1 |
| InChI | InChI=1S/C21H25N3O3S/c1-2-3-12-22-21(25)16-7-6-8-18(14-16)28(26,27)24-13-11-17-15-23-20-10-5-4-9-19(17)20/h4-10,14-15,23-24H,2-3,11-13H2,1H3,(H,22,25) |
| InChIKey | HQYMEPPZMMCTOG-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 91.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.52 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|