C20H21N3O3S — CID 30867031
3-(cyclopropylsulfamoyl)-N-[2-(1H-indol-3-yl)ethyl]benzamide (PubChem CID 30867031) has the molecular formula C20H21N3O3S and a molecular weight of 383.47 g/mol. Its IUPAC name is 3-(cyclopropylsulfamoyl)-N-[2-(1H-indol-3-yl)ethyl]benzamide.
| Compound Name | 3-(cyclopropylsulfamoyl)-N-[2-(1H-indol-3-yl)ethyl]benzamide |
|---|---|
| PubChem CID | 30867031 |
| Molecular Formula | C20H21N3O3S |
| Molecular Weight | 383.47 g/mol |
| Exact Mass | 383.13 |
| IUPAC Name | 3-(cyclopropylsulfamoyl)-N-[2-(1H-indol-3-yl)ethyl]benzamide |
| SMILES | O=C(NCCc1c[nH]c2ccccc12)c1cccc(S(=O)(=O)NC2CC2)c1 |
| InChI | InChI=1S/C20H21N3O3S/c24-20(21-11-10-15-13-22-19-7-2-1-6-18(15)19)14-4-3-5-17(12-14)27(25,26)23-16-8-9-16/h1-7,12-13,16,22-23H,8-11H2,(H,21,24) |
| InChIKey | MSTDKWPVSVKLSP-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 91.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.47 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |