C11H11F3N2O2S — CID 106386056
1,1,1-trifluoro-N-[2-(1H-indol-3-yl)ethyl]methanesulfonamide (PubChem CID 106386056) has the molecular formula C11H11F3N2O2S and a molecular weight of 292.28 g/mol. Its IUPAC name is 1,1,1-trifluoro-N-[2-(1H-indol-3-yl)ethyl]methanesulfonamide.
| Compound Name | 1,1,1-trifluoro-N-[2-(1H-indol-3-yl)ethyl]methanesulfonamide |
|---|---|
| PubChem CID | 106386056 |
| Molecular Formula | C11H11F3N2O2S |
| Molecular Weight | 292.28 g/mol |
| Exact Mass | 292.05 |
| IUPAC Name | 1,1,1-trifluoro-N-[2-(1H-indol-3-yl)ethyl]methanesulfonamide |
| SMILES | O=S(=O)(NCCc1c[nH]c2ccccc12)C(F)(F)F |
| InChI | InChI=1S/C11H11F3N2O2S/c12-11(13,14)19(17,18)16-6-5-8-7-15-10-4-2-1-3-9(8)10/h1-4,7,15-16H,5-6H2 |
| InChIKey | DCDMDJVVHPTTOS-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 61.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.28 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |