C18H16N4O4S — CID 25039281
N-[2-(1H-indol-3-yl)ethyl]-2,3-dioxo-1,4-dihydroquinoxaline-6-sulfonamide (PubChem CID 25039281) has the molecular formula C18H16N4O4S and a molecular weight of 384.42 g/mol. Its IUPAC name is N-[2-(1H-indol-3-yl)ethyl]-2,3-dioxo-1,4-dihydroquinoxaline-6-sulfonamide.
| Compound Name | N-[2-(1H-indol-3-yl)ethyl]-2,3-dioxo-1,4-dihydroquinoxaline-6-sulfonamide |
|---|---|
| PubChem CID | 25039281 |
| Molecular Formula | C18H16N4O4S |
| Molecular Weight | 384.42 g/mol |
| Exact Mass | 384.09 |
| IUPAC Name | N-[2-(1H-indol-3-yl)ethyl]-2,3-dioxo-1,4-dihydroquinoxaline-6-sulfonamide |
| SMILES | O=c1[nH]c2ccc(S(=O)(=O)NCCc3c[nH]c4ccccc34)cc2[nH]c1=O |
| InChI | InChI=1S/C18H16N4O4S/c23-17-18(24)22-16-9-12(5-6-15(16)21-17)27(25,26)20-8-7-11-10-19-14-4-2-1-3-13(11)14/h1-6,9-10,19-20H,7-8H2,(H,21,23)(H,22,24) |
| InChIKey | VGSYNLIOZZCBGZ-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 127.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.42 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|