C18H17N3O3S — CID 90624527
1-(1,2-benzoxazol-3-yl)-N-[2-(1H-indol-3-yl)ethyl]methanesulfonamide (PubChem CID 90624527) has the molecular formula C18H17N3O3S and a molecular weight of 355.42 g/mol. Its IUPAC name is 1-(1,2-benzoxazol-3-yl)-N-[2-(1H-indol-3-yl)ethyl]methanesulfonamide.
| Compound Name | 1-(1,2-benzoxazol-3-yl)-N-[2-(1H-indol-3-yl)ethyl]methanesulfonamide |
|---|---|
| PubChem CID | 90624527 |
| Molecular Formula | C18H17N3O3S |
| Molecular Weight | 355.42 g/mol |
| Exact Mass | 355.10 |
| IUPAC Name | 1-(1,2-benzoxazol-3-yl)-N-[2-(1H-indol-3-yl)ethyl]methanesulfonamide |
| SMILES | O=S(=O)(Cc1noc2ccccc12)NCCc1c[nH]c2ccccc12 |
| InChI | InChI=1S/C18H17N3O3S/c22-25(23,12-17-15-6-2-4-8-18(15)24-21-17)20-10-9-13-11-19-16-7-3-1-5-14(13)16/h1-8,11,19-20H,9-10,12H2 |
| InChIKey | NSGNSXBBYXBOIU-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 87.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.42 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |