C21H22N4O2 — CID 67855202
5-[[3-(2-aminoethyl)-1H-indol-5-yl]methyl]-1-benzylimidazolidine-2,4-dione (PubChem CID 67855202) has the molecular formula C21H22N4O2 and a molecular weight of 362.43 g/mol. Its IUPAC name is 5-[[3-(2-aminoethyl)-1H-indol-5-yl]methyl]-1-benzylimidazolidine-2,4-dione.
| Compound Name | 5-[[3-(2-aminoethyl)-1H-indol-5-yl]methyl]-1-benzylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 67855202 |
| Molecular Formula | C21H22N4O2 |
| Molecular Weight | 362.43 g/mol |
| Exact Mass | 362.17 |
| IUPAC Name | 5-[[3-(2-aminoethyl)-1H-indol-5-yl]methyl]-1-benzylimidazolidine-2,4-dione |
| SMILES | NCCc1c[nH]c2ccc(CC3C(=O)NC(=O)N3Cc3ccccc3)cc12 |
| InChI | InChI=1S/C21H22N4O2/c22-9-8-16-12-23-18-7-6-15(10-17(16)18)11-19-20(26)24-21(27)25(19)13-14-4-2-1-3-5-14/h1-7,10,12,19,23H,8-9,11,13,22H2,(H,24,26,27) |
| InChIKey | PYMLNFVPCUNIMF-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 91.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.43 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|