C15H20N2O4 — CID 21071579
oxalic acid;2-(5-propan-2-yl-1H-indol-3-yl)ethanamine (PubChem CID 21071579) has the molecular formula C15H20N2O4 and a molecular weight of 292.34 g/mol. Its IUPAC name is oxalic acid;2-(5-propan-2-yl-1H-indol-3-yl)ethanamine.
| Compound Name | oxalic acid;2-(5-propan-2-yl-1H-indol-3-yl)ethanamine |
|---|---|
| PubChem CID | 21071579 |
| Molecular Formula | C15H20N2O4 |
| Molecular Weight | 292.34 g/mol |
| Exact Mass | 292.14 |
| IUPAC Name | oxalic acid;2-(5-propan-2-yl-1H-indol-3-yl)ethanamine |
| SMILES | CC(C)c1ccc2[nH]cc(CCN)c2c1.O=C(O)C(=O)O |
| InChI | InChI=1S/C13H18N2.C2H2O4/c1-9(2)10-3-4-13-12(7-10)11(5-6-14)8-15-13;3-1(4)2(5)6/h3-4,7-9,15H,5-6,14H2,1-2H3;(H,3,4)(H,5,6) |
| InChIKey | VVMZTHXBEUODHD-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 116.41 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.34 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|