C22H25ClN4O2 — CID 67634312
2-[3-(2-aminoethyl)-1H-indol-5-yl]-2-[4-(4-chlorophenyl)piperazin-1-yl]acetic acid (PubChem CID 67634312) has the molecular formula C22H25ClN4O2 and a molecular weight of 412.92 g/mol. Its IUPAC name is 2-[3-(2-aminoethyl)-1H-indol-5-yl]-2-[4-(4-chlorophenyl)piperazin-1-yl]acetic acid.
| Compound Name | 2-[3-(2-aminoethyl)-1H-indol-5-yl]-2-[4-(4-chlorophenyl)piperazin-1-yl]acetic acid |
|---|---|
| PubChem CID | 67634312 |
| Molecular Formula | C22H25ClN4O2 |
| Molecular Weight | 412.92 g/mol |
| Exact Mass | 412.17 |
| IUPAC Name | 2-[3-(2-aminoethyl)-1H-indol-5-yl]-2-[4-(4-chlorophenyl)piperazin-1-yl]acetic acid |
| SMILES | NCCc1c[nH]c2ccc(C(C(=O)O)N3CCN(c4ccc(Cl)cc4)CC3)cc12 |
| InChI | InChI=1S/C22H25ClN4O2/c23-17-2-4-18(5-3-17)26-9-11-27(12-10-26)21(22(28)29)15-1-6-20-19(13-15)16(7-8-24)14-25-20/h1-6,13-14,21,25H,7-12,24H2,(H,28,29) |
| InChIKey | OJBWJCOXRPRKNJ-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 85.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.92 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |