C26H36ClN5O2 — CID 19691191
6-[[3-(2-aminoethyl)-1H-indol-5-yl]oxy]-1-[4-(4-aminophenyl)piperazin-1-yl]hexan-1-one;hydrochloride (PubChem CID 19691191) has the molecular formula C26H36ClN5O2 and a molecular weight of 486.06 g/mol. Its IUPAC name is 6-[[3-(2-aminoethyl)-1H-indol-5-yl]oxy]-1-[4-(4-aminophenyl)piperazin-1-yl]hexan-1-one;hydrochloride.
| Compound Name | 6-[[3-(2-aminoethyl)-1H-indol-5-yl]oxy]-1-[4-(4-aminophenyl)piperazin-1-yl]hexan-1-one;hydrochloride |
|---|---|
| PubChem CID | 19691191 |
| Molecular Formula | C26H36ClN5O2 |
| Molecular Weight | 486.06 g/mol |
| Exact Mass | 485.26 |
| IUPAC Name | 6-[[3-(2-aminoethyl)-1H-indol-5-yl]oxy]-1-[4-(4-aminophenyl)piperazin-1-yl]hexan-1-one;hydrochloride |
| SMILES | Cl.NCCc1c[nH]c2ccc(OCCCCCC(=O)N3CCN(c4ccc(N)cc4)CC3)cc12 |
| InChI | InChI=1S/C26H35N5O2.ClH/c27-12-11-20-19-29-25-10-9-23(18-24(20)25)33-17-3-1-2-4-26(32)31-15-13-30(14-16-31)22-7-5-21(28)6-8-22;/h5-10,18-19,29H,1-4,11-17,27-28H2;1H |
| InChIKey | TWMXWGNWNQCSSD-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 100.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.06 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|