C28H38N4O2 — CID 90905106
ethane;1-[4-(4-isocyanophenyl)piperazin-1-yl]-2-[(3-propyl-1H-indol-5-yl)oxy]ethanone (PubChem CID 90905106) has the molecular formula C28H38N4O2 and a molecular weight of 462.64 g/mol. Its IUPAC name is ethane;1-[4-(4-isocyanophenyl)piperazin-1-yl]-2-[(3-propyl-1H-indol-5-yl)oxy]ethanone.
| Compound Name | ethane;1-[4-(4-isocyanophenyl)piperazin-1-yl]-2-[(3-propyl-1H-indol-5-yl)oxy]ethanone |
|---|---|
| PubChem CID | 90905106 |
| Molecular Formula | C28H38N4O2 |
| Molecular Weight | 462.64 g/mol |
| Exact Mass | 462.30 |
| IUPAC Name | ethane;1-[4-(4-isocyanophenyl)piperazin-1-yl]-2-[(3-propyl-1H-indol-5-yl)oxy]ethanone |
| SMILES | CC.CC.[C-]#[N+]c1ccc(N2CCN(C(=O)COc3ccc4[nH]cc(CCC)c4c3)CC2)cc1 |
| InChI | InChI=1S/C24H26N4O2.2C2H6/c1-3-4-18-16-26-23-10-9-21(15-22(18)23)30-17-24(29)28-13-11-27(12-14-28)20-7-5-19(25-2)6-8-20;2*1-2/h5-10,15-16,26H,3-4,11-14,17H2,1H3;2*1-2H3 |
| InChIKey | YFUJKWPBQYJTMF-UHFFFAOYSA-N |
| XLogP | 6.45 |
| TPSA | 52.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.64 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|