5-ethoxy-3-propyl-1H-indole;formic acid

C15H21NO5 — CID 142107070

IUPAC5-ethoxy-3-propyl-1H-indole;formic acid
SMILESCCCc1c[nH]c2ccc(OCC)cc12.O=CO.O=CO
InChIInChI=1S/C13H17NO.2CH2O2/c1-3-5-10-9-14-13-7-6-11(15-4-2)8-12(10)13;2*2-1-3/h6-9,14H,3-5H2,1-2H3;2*1H,(H,2,3)
InChIKeyYAWKXTDNOQZRNI-UHFFFAOYSA-N
MW295.33 g/mol
LogP2.92
Rot. Bonds4

About 5-ethoxy-3-propyl-1H-indole;formic acid

5-ethoxy-3-propyl-1H-indole;formic acid (PubChem CID 142107070) has the molecular formula C15H21NO5 and a molecular weight of 295.33 g/mol. Its IUPAC name is 5-ethoxy-3-propyl-1H-indole;formic acid.

Molecular Properties

Compound Name5-ethoxy-3-propyl-1H-indole;formic acid
PubChem CID142107070
Molecular FormulaC15H21NO5
Molecular Weight295.33 g/mol
Exact Mass295.14
IUPAC Name5-ethoxy-3-propyl-1H-indole;formic acid
SMILESCCCc1c[nH]c2ccc(OCC)cc12.O=CO.O=CO
InChIInChI=1S/C13H17NO.2CH2O2/c1-3-5-10-9-14-13-7-6-11(15-4-2)8-12(10)13;2*2-1-3/h6-9,14H,3-5H2,1-2H3;2*1H,(H,2,3)
InChIKeyYAWKXTDNOQZRNI-UHFFFAOYSA-N
XLogP2.92
TPSA99.62 Ų
H-Bond Donors3
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms21
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500295.33
LogP ≤ 52.92
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'aldehyde', 'substructure': 'N/A'}

Analyze 5-ethoxy-3-propyl-1H-indole;formic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5-ethoxy-3-propyl-1H-indole;formic acid?
The IUPAC name of 5-ethoxy-3-propyl-1H-indole;formic acid (CID 142107070) is 5-ethoxy-3-propyl-1H-indole;formic acid.
What is the SMILES notation for 5-ethoxy-3-propyl-1H-indole;formic acid?
The canonical SMILES for 5-ethoxy-3-propyl-1H-indole;formic acid is CCCc1c[nH]c2ccc(OCC)cc12.O=CO.O=CO.
What is the InChIKey of 5-ethoxy-3-propyl-1H-indole;formic acid?
The InChIKey is YAWKXTDNOQZRNI-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17NO.2CH2O2/c1-3-5-10-9-14-13-7-6-11(15-4-2)8-12(10)13;2*2-1-3/h6-9,14H,3-5H2,1-2H3;2*1H,(H,2,3).
What are the key properties of 5-ethoxy-3-propyl-1H-indole;formic acid?
5-ethoxy-3-propyl-1H-indole;formic acid has a molecular weight of 295.33 g/mol, XLogP of 2.92, 4 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-ethoxy-3-propyl-1H-indole;formic acid is sourced from PubChem (CID 142107070), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).