C29H29N5O2S — CID 15411583
2-[[3-(2-aminoethyl)-1H-indol-5-yl]oxy]-1-[4-[4-(1,3-benzothiazol-2-yl)phenyl]piperazin-1-yl]ethanone (PubChem CID 15411583) has the molecular formula C29H29N5O2S and a molecular weight of 511.65 g/mol. Its IUPAC name is 2-[[3-(2-aminoethyl)-1H-indol-5-yl]oxy]-1-[4-[4-(1,3-benzothiazol-2-yl)phenyl]piperazin-1-yl]ethanone.
| Compound Name | 2-[[3-(2-aminoethyl)-1H-indol-5-yl]oxy]-1-[4-[4-(1,3-benzothiazol-2-yl)phenyl]piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 15411583 |
| Molecular Formula | C29H29N5O2S |
| Molecular Weight | 511.65 g/mol |
| Exact Mass | 511.20 |
| IUPAC Name | 2-[[3-(2-aminoethyl)-1H-indol-5-yl]oxy]-1-[4-[4-(1,3-benzothiazol-2-yl)phenyl]piperazin-1-yl]ethanone |
| SMILES | NCCc1c[nH]c2ccc(OCC(=O)N3CCN(c4ccc(-c5nc6ccccc6s5)cc4)CC3)cc12 |
| InChI | InChI=1S/C29H29N5O2S/c30-12-11-21-18-31-25-10-9-23(17-24(21)25)36-19-28(35)34-15-13-33(14-16-34)22-7-5-20(6-8-22)29-32-26-3-1-2-4-27(26)37-29/h1-10,17-18,31H,11-16,19,30H2 |
| InChIKey | CBCLEFNZKRTRDG-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 87.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.65 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_G(9)', 'substructure': 'N/A'} |
|---|